C29H30ClF3N5O3S- — CID 169251973
5-[4-(2-aminoquinoxalin-6-yl)-N-(2,2,2-trifluoroethyl)anilino]-2-(2-chloroethoxy)-3-methylbenzonitrile;ethane;methanesulfinate (PubChem CID 169251973) has the molecular formula C29H30ClF3N5O3S- and a molecular weight of 621.11 g/mol. Its IUPAC name is 5-[4-(2-aminoquinoxalin-6-yl)-N-(2,2,2-trifluoroethyl)anilino]-2-(2-chloroethoxy)-3-methylbenzonitrile;ethane;methanesulfinate.
| Compound Name | 5-[4-(2-aminoquinoxalin-6-yl)-N-(2,2,2-trifluoroethyl)anilino]-2-(2-chloroethoxy)-3-methylbenzonitrile;ethane;methanesulfinate |
|---|---|
| PubChem CID | 169251973 |
| Molecular Formula | C29H30ClF3N5O3S- |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 5-[4-(2-aminoquinoxalin-6-yl)-N-(2,2,2-trifluoroethyl)anilino]-2-(2-chloroethoxy)-3-methylbenzonitrile;ethane;methanesulfinate |
| SMILES | CC.CS(=O)[O-].Cc1cc(N(CC(F)(F)F)c2ccc(-c3ccc4nc(N)cnc4c3)cc2)cc(C#N)c1OCCCl |
| InChI | InChI=1S/C26H21ClF3N5O.C2H6.CH4O2S/c1-16-10-21(11-19(13-31)25(16)36-9-8-27)35(15-26(28,29)30)20-5-2-17(3-6-20)18-4-7-22-23(12-18)33-14-24(32)34-22;1-2;1-4(2)3/h2-7,10-12,14H,8-9,15H2,1H3,(H2,32,34);1-2H3;1H3,(H,2,3)/p-1 |
| InChIKey | JQDLJQYZPIAFBW-UHFFFAOYSA-M |
| XLogP | 6.90 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|