About (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium
(Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium (PubChem CID 169252444) has the molecular formula C11H16IrN2O5
and a molecular weight of 448.48 g/mol. Its IUPAC name is (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium.
Molecular Properties
| Compound Name | (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium |
| PubChem CID | 169252444 |
| Molecular Formula | C11H16IrN2O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium |
| SMILES | C/C(=C/N(C)C1CC(O)C(C=O)O1)C(=O)NC=O.[Ir] |
| InChI | InChI=1S/C11H16N2O5.Ir/c1-7(11(17)12-6-15)4-13(2)10-3-8(16)9(5-14)18-10;/h4-6,8-10,16H,3H2,1-2H3,(H,12,15,17);/b7-4-; |
| InChIKey | XKBSBIFXLSCMOL-ZULQGGHCSA-N |
| XLogP | -1.23 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium?
The IUPAC name of (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium (CID 169252444) is (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium.
What is the SMILES notation for (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium?
The canonical SMILES for (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium is C/C(=C/N(C)C1CC(O)C(C=O)O1)C(=O)NC=O.[Ir].
What is the InChIKey of (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium?
The InChIKey is XKBSBIFXLSCMOL-ZULQGGHCSA-N. The full InChI is InChI=1S/C11H16N2O5.Ir/c1-7(11(17)12-6-15)4-13(2)10-3-8(16)9(5-14)18-10;/h4-6,8-10,16H,3H2,1-2H3,(H,12,15,17);/b7-4-;.
What are the key properties of (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium?
(Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium has a molecular weight of 448.48 g/mol, XLogP of -1.23, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-formyl-3-[(5-formyl-4-hydroxyoxolan-2-yl)-methylamino]-2-methylprop-2-enamide;iridium is sourced from PubChem (CID 169252444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).