C23H22ClN9O2 — CID 169254079
3-[1-[[6-chloro-2-(2-methyltetrazol-5-yl)-3-pyridinyl]amino]-2-hydroxyethyl]-5-methyl-9,13,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,14-pentaen-8-one (PubChem CID 169254079) has the molecular formula C23H22ClN9O2 and a molecular weight of 491.94 g/mol. Its IUPAC name is 3-[1-[[6-chloro-2-(2-methyltetrazol-5-yl)-3-pyridinyl]amino]-2-hydroxyethyl]-5-methyl-9,13,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,14-pentaen-8-one.
| Compound Name | 3-[1-[[6-chloro-2-(2-methyltetrazol-5-yl)-3-pyridinyl]amino]-2-hydroxyethyl]-5-methyl-9,13,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,14-pentaen-8-one |
|---|---|
| PubChem CID | 169254079 |
| Molecular Formula | C23H22ClN9O2 |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[1-[[6-chloro-2-(2-methyltetrazol-5-yl)-3-pyridinyl]amino]-2-hydroxyethyl]-5-methyl-9,13,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2(7),3,5,14-pentaen-8-one |
| SMILES | Cc1cc(C(CO)Nc2ccc(Cl)nc2-c2nnn(C)n2)c2c(c1)c(=O)n1c3c2cnn3CCC1 |
| InChI | InChI=1S/C23H22ClN9O2/c1-12-8-13(19-14(9-12)23(35)32-6-3-7-33-22(32)15(19)10-25-33)17(11-34)26-16-4-5-18(24)27-20(16)21-28-30-31(2)29-21/h4-5,8-10,17,26,34H,3,6-7,11H2,1-2H3 |
| InChIKey | WHOPWKGXRPEUIN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|