C9H13N2O+ — CID 169254152
1-acetyl-4-methyl-3,5-dihydro-2H-pyridin-1-ium-4-carbonitrile (PubChem CID 169254152) has the molecular formula C9H13N2O+ and a molecular weight of 165.22 g/mol. Its IUPAC name is 1-acetyl-4-methyl-3,5-dihydro-2H-pyridin-1-ium-4-carbonitrile.
| Compound Name | 1-acetyl-4-methyl-3,5-dihydro-2H-pyridin-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 169254152 |
| Molecular Formula | C9H13N2O+ |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 1-acetyl-4-methyl-3,5-dihydro-2H-pyridin-1-ium-4-carbonitrile |
| SMILES | CC(=O)[N+]1=CCC(C)(C#N)CC1 |
| InChI | InChI=1S/C9H13N2O/c1-8(12)11-5-3-9(2,7-10)4-6-11/h5H,3-4,6H2,1-2H3/q+1 |
| InChIKey | WRELZKHUXBYFLJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 43.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|