C19H28F3N3O2 — CID 169254396
(2R,7S)-18,18,23-trifluoro-2-methyl-8,16-dioxa-3,5,6-triazatricyclo[17.3.1.04,7]tricosa-1(23),19,21-triene (PubChem CID 169254396) has the molecular formula C19H28F3N3O2 and a molecular weight of 387.45 g/mol. Its IUPAC name is (2R,7S)-18,18,23-trifluoro-2-methyl-8,16-dioxa-3,5,6-triazatricyclo[17.3.1.04,7]tricosa-1(23),19,21-triene.
| Compound Name | (2R,7S)-18,18,23-trifluoro-2-methyl-8,16-dioxa-3,5,6-triazatricyclo[17.3.1.04,7]tricosa-1(23),19,21-triene |
|---|---|
| PubChem CID | 169254396 |
| Molecular Formula | C19H28F3N3O2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (2R,7S)-18,18,23-trifluoro-2-methyl-8,16-dioxa-3,5,6-triazatricyclo[17.3.1.04,7]tricosa-1(23),19,21-triene |
| SMILES | C[C@H]1NC2NN[C@H]2OCCCCCCCOCC(F)(F)c2cccc1c2F |
| InChI | InChI=1S/C19H28F3N3O2/c1-13-14-8-7-9-15(16(14)20)19(21,22)12-26-10-5-3-2-4-6-11-27-18-17(23-13)24-25-18/h7-9,13,17-18,23-25H,2-6,10-12H2,1H3/t13-,17?,18+/m1/s1 |
| InChIKey | AXZHTQKPBSKOFQ-ODPJWBIYSA-N |
| XLogP | 3.33 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |