C21H27ClFN5O4S — CID 169255003
tert-butyl 12-chloro-16-ethylsulfonyl-13-fluoro-7-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate (PubChem CID 169255003) has the molecular formula C21H27ClFN5O4S and a molecular weight of 500.00 g/mol. Its IUPAC name is tert-butyl 12-chloro-16-ethylsulfonyl-13-fluoro-7-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate.
| Compound Name | tert-butyl 12-chloro-16-ethylsulfonyl-13-fluoro-7-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 169255003 |
| Molecular Formula | C21H27ClFN5O4S |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | tert-butyl 12-chloro-16-ethylsulfonyl-13-fluoro-7-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate |
| SMILES | CCS(=O)(=O)c1nc2c3c(nc(Cl)c(F)c3n1)CCC1(C)CN(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C21H27ClFN5O4S/c1-6-33(30,31)18-25-15-13-12(24-16(22)14(15)23)7-8-21(5)11-27(19(29)32-20(2,3)4)9-10-28(21)17(13)26-18/h6-11H2,1-5H3 |
| InChIKey | ZFRZFKJXMJSWLE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 105.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|