C23H34ClFN6O2S — CID 169255214
butylamino 12-chloro-7-ethyl-16-ethylsulfanyl-13-fluoro-9-methyl-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate (PubChem CID 169255214) has the molecular formula C23H34ClFN6O2S and a molecular weight of 513.08 g/mol. Its IUPAC name is butylamino 12-chloro-7-ethyl-16-ethylsulfanyl-13-fluoro-9-methyl-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate.
| Compound Name | butylamino 12-chloro-7-ethyl-16-ethylsulfanyl-13-fluoro-9-methyl-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 169255214 |
| Molecular Formula | C23H34ClFN6O2S |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | butylamino 12-chloro-7-ethyl-16-ethylsulfanyl-13-fluoro-9-methyl-2,5,11,15,17-pentazatricyclo[8.7.1.014,18]octadeca-1(17),10,12,14(18),15-pentaene-5-carboxylate |
| SMILES | CCCCNOC(=O)N1CCNc2nc(SCC)nc3c(F)c(Cl)nc(c23)C(C)CC(CC)C1 |
| InChI | InChI=1S/C23H34ClFN6O2S/c1-5-8-9-27-33-23(32)31-11-10-26-21-16-18(14(4)12-15(6-2)13-31)28-20(24)17(25)19(16)29-22(30-21)34-7-3/h14-15,27H,5-13H2,1-4H3,(H,26,29,30) |
| InChIKey | ARVMQJJQSBHEET-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|