C13H16F9NO2 — CID 169255290
[(3S,8S)-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 169255290) has the molecular formula C13H16F9NO2 and a molecular weight of 389.26 g/mol. Its IUPAC name is [(3S,8S)-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(3S,8S)-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 169255290 |
| Molecular Formula | C13H16F9NO2 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [(3S,8S)-3-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | OC[C@@]12CCCN1[C@H](COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H16F9NO2/c14-11(15,16)10(12(17,18)19,13(20,21)22)25-6-8-2-4-9(7-24)3-1-5-23(8)9/h8,24H,1-7H2/t8-,9-/m0/s1 |
| InChIKey | RAQZRSFPHMJORM-IUCAKERBSA-N |
| XLogP | 3.42 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |