C23H31ClFN5O2S — CID 169255555
tert-butyl (6S,7S,8R)-12-chloro-6-ethyl-16-ethylsulfanyl-13-fluoro-8-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate (PubChem CID 169255555) has the molecular formula C23H31ClFN5O2S and a molecular weight of 496.05 g/mol. Its IUPAC name is tert-butyl (6S,7S,8R)-12-chloro-6-ethyl-16-ethylsulfanyl-13-fluoro-8-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate.
| Compound Name | tert-butyl (6S,7S,8R)-12-chloro-6-ethyl-16-ethylsulfanyl-13-fluoro-8-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 169255555 |
| Molecular Formula | C23H31ClFN5O2S |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | tert-butyl (6S,7S,8R)-12-chloro-6-ethyl-16-ethylsulfanyl-13-fluoro-8-methyl-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene-5-carboxylate |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)C[C@@H](C)[C@H]1[C@H](CC)N(C(=O)OC(C)(C)C)CCN21 |
| InChI | InChI=1S/C23H31ClFN5O2S/c1-7-14-18-12(3)11-13-15-17(16(25)19(24)26-13)27-21(33-8-2)28-20(15)30(18)10-9-29(14)22(31)32-23(4,5)6/h12,14,18H,7-11H2,1-6H3/t12-,14+,18+/m1/s1 |
| InChIKey | HSMFRVBYQPVKCZ-IAISJRAMSA-N |
| XLogP | 5.33 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|