C12H23F3NO2+ — CID 169255572
propane;[(2R,8R)-2-(trifluoromethoxy)-2,3,4,5,6,7-hexahydro-1H-pyrrolizin-4-ium-8-yl]methanol (PubChem CID 169255572) has the molecular formula C12H23F3NO2+ and a molecular weight of 270.31 g/mol. Its IUPAC name is propane;[(2R,8R)-2-(trifluoromethoxy)-2,3,4,5,6,7-hexahydro-1H-pyrrolizin-4-ium-8-yl]methanol.
| Compound Name | propane;[(2R,8R)-2-(trifluoromethoxy)-2,3,4,5,6,7-hexahydro-1H-pyrrolizin-4-ium-8-yl]methanol |
|---|---|
| PubChem CID | 169255572 |
| Molecular Formula | C12H23F3NO2+ |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | propane;[(2R,8R)-2-(trifluoromethoxy)-2,3,4,5,6,7-hexahydro-1H-pyrrolizin-4-ium-8-yl]methanol |
| SMILES | CCC.OC[C@]12CCC[NH+]1C[C@H](OC(F)(F)F)C2 |
| InChI | InChI=1S/C9H14F3NO2.C3H8/c10-9(11,12)15-7-4-8(6-14)2-1-3-13(8)5-7;1-3-2/h7,14H,1-6H2;3H2,1-2H3/p+1/t7-,8-;/m1./s1 |
| InChIKey | MQTYWQLCAGIBBI-SCLLHFNJSA-O |
| XLogP | 1.12 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |