C13H21F3N2O3 — CID 169255589
[(3S,8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate (PubChem CID 169255589) has the molecular formula C13H21F3N2O3 and a molecular weight of 310.32 g/mol. Its IUPAC name is [(3S,8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate.
| Compound Name | [(3S,8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 169255589 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [(3S,8S)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate |
| SMILES | COC[C@@]12CCCN1[C@H](COC(=O)N(C)C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H21F3N2O3/c1-17(13(14,15)16)11(19)21-8-10-4-6-12(9-20-2)5-3-7-18(10)12/h10H,3-9H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | IUHREZUPVWTCOS-JQWIXIFHSA-N |
| XLogP | 2.22 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|