C13H21F6NO2 — CID 169255888
1,1,1,3,3,3-hexafluoro-2-methoxy-2-methylpropane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol (PubChem CID 169255888) has the molecular formula C13H21F6NO2 and a molecular weight of 337.30 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-methoxy-2-methylpropane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-methoxy-2-methylpropane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol |
|---|---|
| PubChem CID | 169255888 |
| Molecular Formula | C13H21F6NO2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-methoxy-2-methylpropane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol |
| SMILES | COC(C)(C(F)(F)F)C(F)(F)F.OCC12CCCN1CCC2 |
| InChI | InChI=1S/C8H15NO.C5H6F6O/c10-7-8-3-1-5-9(8)6-2-4-8;1-3(12-2,4(6,7)8)5(9,10)11/h10H,1-7H2;1-2H3 |
| InChIKey | QFGAYFVMVNALHM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |