C15H17ClFN5S — CID 169255906
12-chloro-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene (PubChem CID 169255906) has the molecular formula C15H17ClFN5S and a molecular weight of 353.85 g/mol. Its IUPAC name is 12-chloro-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene.
| Compound Name | 12-chloro-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
|---|---|
| PubChem CID | 169255906 |
| Molecular Formula | C15H17ClFN5S |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 12-chloro-16-ethylsulfanyl-13-fluoro-2,5,11,15,17-pentazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10(18),11,13,15-pentaene |
| SMILES | CCSc1nc2c3c(nc(Cl)c(F)c3n1)CCC1CNCCN21 |
| InChI | InChI=1S/C15H17ClFN5S/c1-2-23-15-20-12-10-9(19-13(16)11(12)17)4-3-8-7-18-5-6-22(8)14(10)21-15/h8,18H,2-7H2,1H3 |
| InChIKey | SKPOTAGNCJXUHN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|