C15H24F9NO2 — CID 169256002
ethane;1,1,1,3,3,3-hexafluoro-2-methoxy-2-(trifluoromethyl)propane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol (PubChem CID 169256002) has the molecular formula C15H24F9NO2 and a molecular weight of 421.34 g/mol. Its IUPAC name is ethane;1,1,1,3,3,3-hexafluoro-2-methoxy-2-(trifluoromethyl)propane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol.
| Compound Name | ethane;1,1,1,3,3,3-hexafluoro-2-methoxy-2-(trifluoromethyl)propane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol |
|---|---|
| PubChem CID | 169256002 |
| Molecular Formula | C15H24F9NO2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | ethane;1,1,1,3,3,3-hexafluoro-2-methoxy-2-(trifluoromethyl)propane;1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethanol |
| SMILES | CC.COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F.OCC12CCCN1CCC2 |
| InChI | InChI=1S/C8H15NO.C5H3F9O.C2H6/c10-7-8-3-1-5-9(8)6-2-4-8;1-15-2(3(6,7)8,4(9,10)11)5(12,13)14;1-2/h10H,1-7H2;1H3;1-2H3 |
| InChIKey | GLXBITIYDVODTM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |