C28H27ClN4O2 — CID 16925613
(1-benzyl-3-phenylmethoxypyrazol-4-yl)-[4-(2-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 16925613) has the molecular formula C28H27ClN4O2 and a molecular weight of 487.00 g/mol. Its IUPAC name is (1-benzyl-3-phenylmethoxypyrazol-4-yl)-[4-(2-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | (1-benzyl-3-phenylmethoxypyrazol-4-yl)-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16925613 |
| Molecular Formula | C28H27ClN4O2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | (1-benzyl-3-phenylmethoxypyrazol-4-yl)-[4-(2-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn(Cc2ccccc2)nc1OCc1ccccc1)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C28H27ClN4O2/c29-25-13-7-8-14-26(25)31-15-17-32(18-16-31)28(34)24-20-33(19-22-9-3-1-4-10-22)30-27(24)35-21-23-11-5-2-6-12-23/h1-14,20H,15-19,21H2 |
| InChIKey | SCLFUNLKACZSEV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |