C9H15F3O2 — CID 169256163
5-ethoxy-1,1,1-trifluoro-3,4-dimethylpentan-2-one (PubChem CID 169256163) has the molecular formula C9H15F3O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 5-ethoxy-1,1,1-trifluoro-3,4-dimethylpentan-2-one.
| Compound Name | 5-ethoxy-1,1,1-trifluoro-3,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 169256163 |
| Molecular Formula | C9H15F3O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-ethoxy-1,1,1-trifluoro-3,4-dimethylpentan-2-one |
| SMILES | CCOCC(C)C(C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3O2/c1-4-14-5-6(2)7(3)8(13)9(10,11)12/h6-7H,4-5H2,1-3H3 |
| InChIKey | CLXUWSPXNAZCIH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |