C17H26BClO2 — CID 169256172
2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 169256172) has the molecular formula C17H26BClO2 and a molecular weight of 318.72 g/mol. Its IUPAC name is 2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169256172 |
| Molecular Formula | C17H26BClO2 |
| Molecular Weight | 318.72 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]c1c(C)c(B2OC(C)(C)C(C)(C)O2)cc(Cl)c1C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C17H26BClO2/c1-11-9-12(15(2,3)4)14(19)10-13(11)18-20-16(5,6)17(7,8)21-18/h9-10H,1-8H3/i2D3,3D3,4D3,9D |
| InChIKey | NDZVTXQNRCRWIA-OIWCTHJWSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|