C20H20ClN3O2 — CID 169256205
2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide (PubChem CID 169256205) has the molecular formula C20H20ClN3O2 and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide.
| Compound Name | 2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
|---|---|
| PubChem CID | 169256205 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2-[5-chloro-3-deuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-methylphenyl]-4-oxo-1H-1,6-naphthyridine-5-carboxamide |
| SMILES | [2H]c1c(C)c(-c2cc(=O)c3c(C(N)=O)nccc3[nH]2)cc(Cl)c1C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H20ClN3O2/c1-10-7-12(20(2,3)4)13(21)8-11(10)15-9-16(25)17-14(24-15)5-6-23-18(17)19(22)26/h5-9H,1-4H3,(H2,22,26)(H,24,25)/i2D3,3D3,4D3,7D |
| InChIKey | NANHVORVOVJFBH-RQSSYMLVSA-N |
| XLogP | 3.95 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |