About 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane
6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane (PubChem CID 169256471) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane |
| PubChem CID | 169256471 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane |
| SMILES | CC.Cc1cc(C)c(=O)[nH]c1C(C)(C)C |
| InChI | InChI=1S/C11H17NO.C2H6/c1-7-6-8(2)10(13)12-9(7)11(3,4)5;1-2/h6H,1-5H3,(H,12,13);1-2H3 |
| InChIKey | HWCKQUUMUDDXNA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane?
The IUPAC name of 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane (CID 169256471) is 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane.
What is the SMILES notation for 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane?
The canonical SMILES for 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane is CC.Cc1cc(C)c(=O)[nH]c1C(C)(C)C.
What is the InChIKey of 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane?
The InChIKey is HWCKQUUMUDDXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO.C2H6/c1-7-6-8(2)10(13)12-9(7)11(3,4)5;1-2/h6H,1-5H3,(H,12,13);1-2H3.
What are the key properties of 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane?
6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane has a molecular weight of 209.33 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3,5-dimethyl-1H-pyridin-2-one;ethane is sourced from PubChem (CID 169256471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).