About fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate
fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate (PubChem CID 169257375) has the molecular formula C21H24F2N2O5
and a molecular weight of 422.43 g/mol. Its IUPAC name is fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate.
Molecular Properties
| Compound Name | fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate |
| PubChem CID | 169257375 |
| Molecular Formula | C21H24F2N2O5 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate |
| SMILES | CC(=O)Nc1cc(Nc2cccc(C)c2C(=O)OF)cc(C(C)(C)C)c1.O=COF |
| InChI | InChI=1S/C20H23FN2O3.CHFO2/c1-12-7-6-8-17(18(12)19(25)26-21)23-16-10-14(20(3,4)5)9-15(11-16)22-13(2)24;2-4-1-3/h6-11,23H,1-5H3,(H,22,24);1H |
| InChIKey | WFMUXKDYTZFNHJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate?
The IUPAC name of fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate (CID 169257375) is fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate.
What is the SMILES notation for fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate?
The canonical SMILES for fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate is CC(=O)Nc1cc(Nc2cccc(C)c2C(=O)OF)cc(C(C)(C)C)c1.O=COF.
What is the InChIKey of fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate?
The InChIKey is WFMUXKDYTZFNHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23FN2O3.CHFO2/c1-12-7-6-8-17(18(12)19(25)26-21)23-16-10-14(20(3,4)5)9-15(11-16)22-13(2)24;2-4-1-3/h6-11,23H,1-5H3,(H,22,24);1H.
What are the key properties of fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate?
fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate has a molecular weight of 422.43 g/mol, XLogP of 5.08, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-(3-acetamido-5-tert-butylanilino)-6-methylbenzoate;fluoro formate is sourced from PubChem (CID 169257375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).