About 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane
5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane (PubChem CID 169257531) has the molecular formula C22H33N
and a molecular weight of 311.51 g/mol. Its IUPAC name is 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane.
Molecular Properties
| Compound Name | 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane |
| PubChem CID | 169257531 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane |
| SMILES | CC.CC(C)c1ccc(-c2ccc(C(C)C(C)(C)C)cn2)cc1 |
| InChI | InChI=1S/C20H27N.C2H6/c1-14(2)16-7-9-17(10-8-16)19-12-11-18(13-21-19)15(3)20(4,5)6;1-2/h7-15H,1-6H3;1-2H3 |
| InChIKey | MJRARQJFXDCSFU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane?
The IUPAC name of 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane (CID 169257531) is 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane.
What is the SMILES notation for 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane?
The canonical SMILES for 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane is CC.CC(C)c1ccc(-c2ccc(C(C)C(C)(C)C)cn2)cc1.
What is the InChIKey of 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane?
The InChIKey is MJRARQJFXDCSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N.C2H6/c1-14(2)16-7-9-17(10-8-16)19-12-11-18(13-21-19)15(3)20(4,5)6;1-2/h7-15H,1-6H3;1-2H3.
What are the key properties of 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane?
5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane has a molecular weight of 311.51 g/mol, XLogP of 7.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylbutan-2-yl)-2-(4-propan-2-ylphenyl)pyridine;ethane is sourced from PubChem (CID 169257531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).