C39H44F2N6O4 — CID 169257587
3-[6-[4-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]piperidin-1-yl]hexoxy]phthalaldehyde (PubChem CID 169257587) has the molecular formula C39H44F2N6O4 and a molecular weight of 698.82 g/mol. Its IUPAC name is 3-[6-[4-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]piperidin-1-yl]hexoxy]phthalaldehyde.
| Compound Name | 3-[6-[4-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]piperidin-1-yl]hexoxy]phthalaldehyde |
|---|---|
| PubChem CID | 169257587 |
| Molecular Formula | C39H44F2N6O4 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 3-[6-[4-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-3-pyridinyl]piperidin-1-yl]hexoxy]phthalaldehyde |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3nc(Nc4ccc(C5CCN(CCCCCCOc6cccc(C=O)c6C=O)CC5)cn4)ncc3F)cc21 |
| InChI | InChI=1S/C39H44F2N6O4/c1-26(2)47-17-19-51-38-32(40)20-30(21-34(38)47)37-33(41)23-43-39(45-37)44-36-11-10-28(22-42-36)27-12-15-46(16-13-27)14-5-3-4-6-18-50-35-9-7-8-29(24-48)31(35)25-49/h7-11,20-27H,3-6,12-19H2,1-2H3,(H,42,43,44,45) |
| InChIKey | XPHYNIJERKLQBL-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|