About (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal
(2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal (PubChem CID 169258108) has the molecular formula C26H56O3Si2
and a molecular weight of 472.90 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal.
Molecular Properties
| Compound Name | (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal |
| PubChem CID | 169258108 |
| Molecular Formula | C26H56O3Si2 |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.38 |
| IUPAC Name | (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal |
| SMILES | CCCCC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H56O3Si2/c1-14-15-16-17-25(28-30(19(2)3,20(4)5)21(6)7)26(18-27)29-31(22(8)9,23(10)11)24(12)13/h18-26H,14-17H2,1-13H3/t25-,26+/m0/s1 |
| InChIKey | RCOWCFMYLCBKHD-IZZNHLLZSA-N |
| XLogP | 8.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal?
The IUPAC name of (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal (CID 169258108) is (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal.
What is the SMILES notation for (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal?
The canonical SMILES for (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal is CCCCC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C=O)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal?
The InChIKey is RCOWCFMYLCBKHD-IZZNHLLZSA-N. The full InChI is InChI=1S/C26H56O3Si2/c1-14-15-16-17-25(28-30(19(2)3,20(4)5)21(6)7)26(18-27)29-31(22(8)9,23(10)11)24(12)13/h18-26H,14-17H2,1-13H3/t25-,26+/m0/s1.
What are the key properties of (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal?
(2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal has a molecular weight of 472.90 g/mol, XLogP of 8.89, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-bis[tri(propan-2-yl)silyloxy]octanal is sourced from PubChem (CID 169258108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).