About ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate
ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 169258444) has the molecular formula C15H12Cl3NO3
and a molecular weight of 360.62 g/mol. Its IUPAC name is ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate |
| PubChem CID | 169258444 |
| Molecular Formula | C15H12Cl3NO3 |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)c(Cl)c(C)[nH]c1=O |
| InChI | InChI=1S/C15H12Cl3NO3/c1-3-22-15(21)12-11(13(18)7(2)19-14(12)20)8-4-5-9(16)10(17)6-8/h4-6H,3H2,1-2H3,(H,19,20) |
| InChIKey | KTKHRWIOPCQSFT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate?
The IUPAC name of ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate (CID 169258444) is ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate?
The canonical SMILES for ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate is CCOC(=O)c1c(-c2ccc(Cl)c(Cl)c2)c(Cl)c(C)[nH]c1=O.
What is the InChIKey of ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate?
The InChIKey is KTKHRWIOPCQSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12Cl3NO3/c1-3-22-15(21)12-11(13(18)7(2)19-14(12)20)8-4-5-9(16)10(17)6-8/h4-6H,3H2,1-2H3,(H,19,20).
What are the key properties of ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate?
ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate has a molecular weight of 360.62 g/mol, XLogP of 4.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-chloro-4-(3,4-dichlorophenyl)-6-methyl-2-oxo-1H-pyridine-3-carboxylate is sourced from PubChem (CID 169258444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).