About [2,4-bis(phosphanyl)phenyl]phosphane
[2,4-bis(phosphanyl)phenyl]phosphane (PubChem CID 169258511) has the molecular formula C6H9P3
and a molecular weight of 174.06 g/mol. Its IUPAC name is [2,4-bis(phosphanyl)phenyl]phosphane.
Molecular Properties
| Compound Name | [2,4-bis(phosphanyl)phenyl]phosphane |
| PubChem CID | 169258511 |
| Molecular Formula | C6H9P3 |
| Molecular Weight | 174.06 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | [2,4-bis(phosphanyl)phenyl]phosphane |
| SMILES | Pc1ccc(P)c(P)c1 |
| InChI | InChI=1S/C6H9P3/c7-4-1-2-5(8)6(9)3-4/h1-3H,7-9H2 |
| InChIKey | NMPJHCUETUFXFH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.06 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,4-bis(phosphanyl)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-bis(phosphanyl)phenyl]phosphane?
The IUPAC name of [2,4-bis(phosphanyl)phenyl]phosphane (CID 169258511) is [2,4-bis(phosphanyl)phenyl]phosphane.
What is the SMILES notation for [2,4-bis(phosphanyl)phenyl]phosphane?
The canonical SMILES for [2,4-bis(phosphanyl)phenyl]phosphane is Pc1ccc(P)c(P)c1.
What is the InChIKey of [2,4-bis(phosphanyl)phenyl]phosphane?
The InChIKey is NMPJHCUETUFXFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9P3/c7-4-1-2-5(8)6(9)3-4/h1-3H,7-9H2.
What are the key properties of [2,4-bis(phosphanyl)phenyl]phosphane?
[2,4-bis(phosphanyl)phenyl]phosphane has a molecular weight of 174.06 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-bis(phosphanyl)phenyl]phosphane is sourced from PubChem (CID 169258511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).