C17H18O5 — CID 169258545
[4-(2-methylprop-2-enoyloxy)-3-propanoylphenyl] 2-methylprop-2-enoate (PubChem CID 169258545) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is [4-(2-methylprop-2-enoyloxy)-3-propanoylphenyl] 2-methylprop-2-enoate.
| Compound Name | [4-(2-methylprop-2-enoyloxy)-3-propanoylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169258545 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [4-(2-methylprop-2-enoyloxy)-3-propanoylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(OC(=O)C(=C)C)c(C(=O)CC)c1 |
| InChI | InChI=1S/C17H18O5/c1-6-14(18)13-9-12(21-16(19)10(2)3)7-8-15(13)22-17(20)11(4)5/h7-9H,2,4,6H2,1,3,5H3 |
| InChIKey | OSIZXXDLRCFVDT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|