About ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium
ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium (PubChem CID 169259890) has the molecular formula C13H23NO2SY-2
and a molecular weight of 346.31 g/mol. Its IUPAC name is ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium.
Molecular Properties
| Compound Name | ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium |
| PubChem CID | 169259890 |
| Molecular Formula | C13H23NO2SY-2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium |
| SMILES | CC.[CH2-]CCN([CH-]C)S(=O)(=O)C1=CCCC=C1.[Y] |
| InChI | InChI=1S/C11H17NO2S.C2H6.Y/c1-3-10-12(4-2)15(13,14)11-8-6-5-7-9-11;1-2;/h4,6,8-9H,1,3,5,7,10H2,2H3;1-2H3;/q-2;; |
| InChIKey | INOTVTOHWBGNTP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium?
The IUPAC name of ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium (CID 169259890) is ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium.
What is the SMILES notation for ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium?
The canonical SMILES for ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium is CC.[CH2-]CCN([CH-]C)S(=O)(=O)C1=CCCC=C1.[Y].
What is the InChIKey of ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium?
The InChIKey is INOTVTOHWBGNTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S.C2H6.Y/c1-3-10-12(4-2)15(13,14)11-8-6-5-7-9-11;1-2;/h4,6,8-9H,1,3,5,7,10H2,2H3;1-2H3;/q-2;;.
What are the key properties of ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium?
ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium has a molecular weight of 346.31 g/mol, XLogP of 3.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-ethyl-N-propylcyclohexa-1,5-diene-1-sulfonamide;yttrium is sourced from PubChem (CID 169259890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).