C22H39N5O3 — CID 169260430
5,5,6,6,8,8,9,9-octamethyl-4-methylidene-2-[2-oxo-2-(2H-tetrazol-5-ylamino)ethyl]decanoic acid (PubChem CID 169260430) has the molecular formula C22H39N5O3 and a molecular weight of 421.59 g/mol. Its IUPAC name is 5,5,6,6,8,8,9,9-octamethyl-4-methylidene-2-[2-oxo-2-(2H-tetrazol-5-ylamino)ethyl]decanoic acid.
| Compound Name | 5,5,6,6,8,8,9,9-octamethyl-4-methylidene-2-[2-oxo-2-(2H-tetrazol-5-ylamino)ethyl]decanoic acid |
|---|---|
| PubChem CID | 169260430 |
| Molecular Formula | C22H39N5O3 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | 5,5,6,6,8,8,9,9-octamethyl-4-methylidene-2-[2-oxo-2-(2H-tetrazol-5-ylamino)ethyl]decanoic acid |
| SMILES | C=C(CC(CC(=O)Nc1nn[nH]n1)C(=O)O)C(C)(C)C(C)(C)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H39N5O3/c1-14(22(9,10)21(7,8)13-20(5,6)19(2,3)4)11-15(17(29)30)12-16(28)23-18-24-26-27-25-18/h15H,1,11-13H2,2-10H3,(H,29,30)(H2,23,24,25,26,27,28) |
| InChIKey | BEHAXEATIMZFQR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|