About (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride
(1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride (PubChem CID 169260887) has the molecular formula C6H11ClF3NO2
and a molecular weight of 221.61 g/mol. Its IUPAC name is (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride |
| PubChem CID | 169260887 |
| Molecular Formula | C6H11ClF3NO2 |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H]1C[C@H](OC(F)(F)F)C[C@@H]1O |
| InChI | InChI=1S/C6H10F3NO2.ClH/c7-6(8,9)12-3-1-4(10)5(11)2-3;/h3-5,11H,1-2,10H2;1H/t3-,4-,5-;/m0./s1 |
| InChIKey | NCIICKVBDGBHEF-SHLRHQAISA-N |
| XLogP | 0.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride?
The IUPAC name of (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride (CID 169260887) is (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride.
What is the SMILES notation for (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride?
The canonical SMILES for (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride is Cl.N[C@H]1C[C@H](OC(F)(F)F)C[C@@H]1O.
What is the InChIKey of (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride?
The InChIKey is NCIICKVBDGBHEF-SHLRHQAISA-N. The full InChI is InChI=1S/C6H10F3NO2.ClH/c7-6(8,9)12-3-1-4(10)5(11)2-3;/h3-5,11H,1-2,10H2;1H/t3-,4-,5-;/m0./s1.
What are the key properties of (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride?
(1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride has a molecular weight of 221.61 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S,4S)-2-amino-4-(trifluoromethoxy)cyclopentan-1-ol;hydrochloride is sourced from PubChem (CID 169260887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).