C10H13ClF2N2O2 — CID 169261461
(2S)-2-(1,1-difluoroethyl)-3,4,5,6-tetrahydro-2H-pyrido[2,3-f][1,4]oxazepin-7-one;hydrochloride (PubChem CID 169261461) has the molecular formula C10H13ClF2N2O2 and a molecular weight of 266.67 g/mol. Its IUPAC name is (2S)-2-(1,1-difluoroethyl)-3,4,5,6-tetrahydro-2H-pyrido[2,3-f][1,4]oxazepin-7-one;hydrochloride.
| Compound Name | (2S)-2-(1,1-difluoroethyl)-3,4,5,6-tetrahydro-2H-pyrido[2,3-f][1,4]oxazepin-7-one;hydrochloride |
|---|---|
| PubChem CID | 169261461 |
| Molecular Formula | C10H13ClF2N2O2 |
| Molecular Weight | 266.67 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (2S)-2-(1,1-difluoroethyl)-3,4,5,6-tetrahydro-2H-pyrido[2,3-f][1,4]oxazepin-7-one;hydrochloride |
| SMILES | CC(F)(F)[C@@H]1CNCc2[nH]c(=O)ccc2O1.Cl |
| InChI | InChI=1S/C10H12F2N2O2.ClH/c1-10(11,12)8-5-13-4-6-7(16-8)2-3-9(15)14-6;/h2-3,8,13H,4-5H2,1H3,(H,14,15);1H/t8-;/m0./s1 |
| InChIKey | NLOFCLLMCUWXBD-QRPNPIFTSA-N |
| XLogP | 1.30 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |