C23H24BNO2S — CID 169262108
3-(5a,9a-dihydrodibenzothiophen-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 169262108) has the molecular formula C23H24BNO2S and a molecular weight of 389.33 g/mol. Its IUPAC name is 3-(5a,9a-dihydrodibenzothiophen-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 3-(5a,9a-dihydrodibenzothiophen-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 169262108 |
| Molecular Formula | C23H24BNO2S |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 3-(5a,9a-dihydrodibenzothiophen-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ncccc2-c2cccc3c2SC2C=CC=CC32)OC1(C)C |
| InChI | InChI=1S/C23H24BNO2S/c1-22(2)23(3,4)27-24(26-22)21-18(12-8-14-25-21)17-11-7-10-16-15-9-5-6-13-19(15)28-20(16)17/h5-15,19H,1-4H3 |
| InChIKey | BRCSEJOQQDALAZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|