C28H33BNO2P — CID 169262125
[9,9-dimethyl-7-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]fluoren-2-yl]-dimethylphosphane (PubChem CID 169262125) has the molecular formula C28H33BNO2P and a molecular weight of 457.36 g/mol. Its IUPAC name is [9,9-dimethyl-7-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]fluoren-2-yl]-dimethylphosphane.
| Compound Name | [9,9-dimethyl-7-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]fluoren-2-yl]-dimethylphosphane |
|---|---|
| PubChem CID | 169262125 |
| Molecular Formula | C28H33BNO2P |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | [9,9-dimethyl-7-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]fluoren-2-yl]-dimethylphosphane |
| SMILES | CP(C)c1ccc2c(c1)C(C)(C)c1cc(-c3ccc(B4OC(C)(C)C(C)(C)O4)nc3)ccc1-2 |
| InChI | InChI=1S/C28H33BNO2P/c1-26(2)23-15-18(9-12-21(23)22-13-11-20(33(7)8)16-24(22)26)19-10-14-25(30-17-19)29-31-27(3,4)28(5,6)32-29/h9-17H,1-8H3 |
| InChIKey | WLWZPPVSCROEFG-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|