About 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene
2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene (PubChem CID 169262128) has the molecular formula C17H18BrOP
and a molecular weight of 349.21 g/mol. Its IUPAC name is 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene.
Molecular Properties
| Compound Name | 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene |
| PubChem CID | 169262128 |
| Molecular Formula | C17H18BrOP |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene |
| SMILES | CC1(C)c2cc(Br)ccc2-c2ccc(P(C)(C)=O)cc21 |
| InChI | InChI=1S/C17H18BrOP/c1-17(2)15-9-11(18)5-7-13(15)14-8-6-12(10-16(14)17)20(3,4)19/h5-10H,1-4H3 |
| InChIKey | AGBMNOWGFUIESV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene?
The IUPAC name of 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene (CID 169262128) is 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene.
What is the SMILES notation for 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene?
The canonical SMILES for 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene is CC1(C)c2cc(Br)ccc2-c2ccc(P(C)(C)=O)cc21.
What is the InChIKey of 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene?
The InChIKey is AGBMNOWGFUIESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrOP/c1-17(2)15-9-11(18)5-7-13(15)14-8-6-12(10-16(14)17)20(3,4)19/h5-10H,1-4H3.
What are the key properties of 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene?
2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene has a molecular weight of 349.21 g/mol, XLogP of 5.00, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-7-dimethylphosphoryl-9,9-dimethylfluorene is sourced from PubChem (CID 169262128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).