C24H23F4N5O — CID 169262346
3-(4-amino-2,6-difluorophenyl)-N-[4-[(3S,5R)-3-amino-5-methylpiperidin-1-yl]-3-pyridinyl]-2,4-difluorobenzamide (PubChem CID 169262346) has the molecular formula C24H23F4N5O and a molecular weight of 473.47 g/mol. Its IUPAC name is 3-(4-amino-2,6-difluorophenyl)-N-[4-[(3S,5R)-3-amino-5-methylpiperidin-1-yl]-3-pyridinyl]-2,4-difluorobenzamide.
| Compound Name | 3-(4-amino-2,6-difluorophenyl)-N-[4-[(3S,5R)-3-amino-5-methylpiperidin-1-yl]-3-pyridinyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 169262346 |
| Molecular Formula | C24H23F4N5O |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 3-(4-amino-2,6-difluorophenyl)-N-[4-[(3S,5R)-3-amino-5-methylpiperidin-1-yl]-3-pyridinyl]-2,4-difluorobenzamide |
| SMILES | C[C@@H]1C[C@H](N)CN(c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(N)cc3F)c2F)C1 |
| InChI | InChI=1S/C24H23F4N5O/c1-12-6-14(30)11-33(10-12)20-4-5-31-9-19(20)32-24(34)15-2-3-16(25)22(23(15)28)21-17(26)7-13(29)8-18(21)27/h2-5,7-9,12,14H,6,10-11,29-30H2,1H3,(H,32,34)/t12-,14+/m1/s1 |
| InChIKey | OXZIRQIEWYHKQN-OCCSQVGLSA-N |
| XLogP | 4.31 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|