About 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine
1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine (PubChem CID 169263026) has the molecular formula C9H14BrNS
and a molecular weight of 248.19 g/mol. Its IUPAC name is 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine |
| PubChem CID | 169263026 |
| Molecular Formula | C9H14BrNS |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine |
| SMILES | CC1=C(Br)SC(C(C)N)=CC1C |
| InChI | InChI=1S/C9H14BrNS/c1-5-4-8(7(3)11)12-9(10)6(5)2/h4-5,7H,11H2,1-3H3 |
| InChIKey | YTBXOQGGWMGULK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine?
The IUPAC name of 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine (CID 169263026) is 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine.
What is the SMILES notation for 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine?
The canonical SMILES for 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine is CC1=C(Br)SC(C(C)N)=CC1C.
What is the InChIKey of 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine?
The InChIKey is YTBXOQGGWMGULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrNS/c1-5-4-8(7(3)11)12-9(10)6(5)2/h4-5,7H,11H2,1-3H3.
What are the key properties of 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine?
1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine has a molecular weight of 248.19 g/mol, XLogP of 3.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-4,5-dimethyl-4H-thiopyran-2-yl)ethanamine is sourced from PubChem (CID 169263026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).