C17H14FN5O2S — CID 169263808
(6E)-3-[(aminosulfanylamino)methyl]-8-fluoro-6-methoxyiminoindolo[2,1-b]quinazolin-12-one (PubChem CID 169263808) has the molecular formula C17H14FN5O2S and a molecular weight of 371.40 g/mol. Its IUPAC name is (6E)-3-[(aminosulfanylamino)methyl]-8-fluoro-6-methoxyiminoindolo[2,1-b]quinazolin-12-one.
| Compound Name | (6E)-3-[(aminosulfanylamino)methyl]-8-fluoro-6-methoxyiminoindolo[2,1-b]quinazolin-12-one |
|---|---|
| PubChem CID | 169263808 |
| Molecular Formula | C17H14FN5O2S |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (6E)-3-[(aminosulfanylamino)methyl]-8-fluoro-6-methoxyiminoindolo[2,1-b]quinazolin-12-one |
| SMILES | CO/N=C1\c2cc(F)ccc2-n2c1nc1cc(CNSN)ccc1c2=O |
| InChI | InChI=1S/C17H14FN5O2S/c1-25-22-15-12-7-10(18)3-5-14(12)23-16(15)21-13-6-9(8-20-26-19)2-4-11(13)17(23)24/h2-7,20H,8,19H2,1H3/b22-15+ |
| InChIKey | ZFSZJWPLCKMJOV-PXLXIMEGSA-N |
| XLogP | 1.85 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|