About N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide
N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide (PubChem CID 169263892) has the molecular formula C17H12FN3O3S
and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide.
Molecular Properties
| Compound Name | N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide |
| PubChem CID | 169263892 |
| Molecular Formula | C17H12FN3O3S |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide |
| SMILES | CS(=O)NCc1ccc2c(=O)n3c(nc2c1)C(=O)c1cc(F)ccc1-3 |
| InChI | InChI=1S/C17H12FN3O3S/c1-25(24)19-8-9-2-4-11-13(6-9)20-16-15(22)12-7-10(18)3-5-14(12)21(16)17(11)23/h2-7,19H,8H2,1H3 |
| InChIKey | MANLPOUWACUWEW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide?
The IUPAC name of N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide (CID 169263892) is N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide.
What is the SMILES notation for N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide?
The canonical SMILES for N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide is CS(=O)NCc1ccc2c(=O)n3c(nc2c1)C(=O)c1cc(F)ccc1-3.
What is the InChIKey of N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide?
The InChIKey is MANLPOUWACUWEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FN3O3S/c1-25(24)19-8-9-2-4-11-13(6-9)20-16-15(22)12-7-10(18)3-5-14(12)21(16)17(11)23/h2-7,19H,8H2,1H3.
What are the key properties of N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide?
N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide has a molecular weight of 357.37 g/mol, XLogP of 1.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-fluoro-6,12-dioxoindolo[2,1-b]quinazolin-3-yl)methyl]methanesulfinamide is sourced from PubChem (CID 169263892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).