About ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine
ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine (PubChem CID 169264123) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine.
Molecular Properties
| Compound Name | ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine |
| PubChem CID | 169264123 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine |
| SMILES | C=CC(/C=N/C)=C(/C=C)N=C.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-5-8(7-10-3)9(6-2)11-4;1-2/h5-7H,1-2,4H2,3H3;1-2H3/b9-8+,10-7+; |
| InChIKey | NSDJCUDUBSWZKK-OVIXOSBESA-N |
| XLogP | 3.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine?
The IUPAC name of ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine (CID 169264123) is ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine.
What is the SMILES notation for ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine?
The canonical SMILES for ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine is C=CC(/C=N/C)=C(/C=C)N=C.CC.
What is the InChIKey of ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine?
The InChIKey is NSDJCUDUBSWZKK-OVIXOSBESA-N. The full InChI is InChI=1S/C9H12N2.C2H6/c1-5-8(7-10-3)9(6-2)11-4;1-2/h5-7H,1-2,4H2,3H3;1-2H3/b9-8+,10-7+;.
What are the key properties of ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine?
ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine has a molecular weight of 178.28 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E)-2-ethenyl-1-N-methyl-3-N-methylidenepenta-2,4-diene-1,3-diimine is sourced from PubChem (CID 169264123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).