C34H32ClF3N4O3 — CID 169264709
4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide (PubChem CID 169264709) has the molecular formula C34H32ClF3N4O3 and a molecular weight of 637.10 g/mol. Its IUPAC name is 4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide.
| Compound Name | 4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 169264709 |
| Molecular Formula | C34H32ClF3N4O3 |
| Molecular Weight | 637.10 g/mol |
| Exact Mass | 636.21 |
| IUPAC Name | 4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(c2ccccc2)c2cc(C(C)(C)O)c(F)c(-c3cc(Cl)c(F)cc3F)n2)cc(/C=N/C2CC2)c1N |
| InChI | InChI=1S/C34H32ClF3N4O3/c1-34(2,44)24-14-28(42-32(30(24)38)22-13-25(35)27(37)15-26(22)36)23(18-7-5-4-6-8-18)17-41-33(43)19-11-20(16-40-21-9-10-21)31(39)29(12-19)45-3/h4-8,11-16,21,23,44H,9-10,17,39H2,1-3H3,(H,41,43)/b40-16+ |
| InChIKey | ZPFVGQZFONTZJX-YQOHXEDVSA-N |
| XLogP | 6.78 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.10 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|