C36H36ClF3N4O3 — CID 169264812
4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(3-hydroxypentan-3-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide (PubChem CID 169264812) has the molecular formula C36H36ClF3N4O3 and a molecular weight of 665.16 g/mol. Its IUPAC name is 4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(3-hydroxypentan-3-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide.
| Compound Name | 4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(3-hydroxypentan-3-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 169264812 |
| Molecular Formula | C36H36ClF3N4O3 |
| Molecular Weight | 665.16 g/mol |
| Exact Mass | 664.24 |
| IUPAC Name | 4-amino-N-[2-[6-(5-chloro-2,4-difluorophenyl)-5-fluoro-4-(3-hydroxypentan-3-yl)-2-pyridinyl]-2-phenylethyl]-3-(cyclopropyliminomethyl)-5-methoxybenzamide |
| SMILES | CCC(O)(CC)c1cc(C(CNC(=O)c2cc(/C=N/C3CC3)c(N)c(OC)c2)c2ccccc2)nc(-c2cc(Cl)c(F)cc2F)c1F |
| InChI | InChI=1S/C36H36ClF3N4O3/c1-4-36(46,5-2)26-16-30(44-34(32(26)40)24-15-27(37)29(39)17-28(24)38)25(20-9-7-6-8-10-20)19-43-35(45)21-13-22(18-42-23-11-12-23)33(41)31(14-21)47-3/h6-10,13-18,23,25,46H,4-5,11-12,19,41H2,1-3H3,(H,43,45)/b42-18+ |
| InChIKey | QDDXAWOOCMOQID-HQILZYGMSA-N |
| XLogP | 7.56 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.16 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|