About methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate
methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate (PubChem CID 169264966) has the molecular formula C16H11ClF3NO2
and a molecular weight of 341.72 g/mol. Its IUPAC name is methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate |
| PubChem CID | 169264966 |
| Molecular Formula | C16H11ClF3NO2 |
| Molecular Weight | 341.72 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccnc(-c3cc(Cl)c(F)cc3F)c2F)CC1 |
| InChI | InChI=1S/C16H11ClF3NO2/c1-23-15(22)16(3-4-16)9-2-5-21-14(13(9)20)8-6-10(17)12(19)7-11(8)18/h2,5-7H,3-4H2,1H3 |
| InChIKey | NWZKKEBBEWCLOS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate (CID 169264966) is methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate is COC(=O)C1(c2ccnc(-c3cc(Cl)c(F)cc3F)c2F)CC1.
What is the InChIKey of methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate?
The InChIKey is NWZKKEBBEWCLOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF3NO2/c1-23-15(22)16(3-4-16)9-2-5-21-14(13(9)20)8-6-10(17)12(19)7-11(8)18/h2,5-7H,3-4H2,1H3.
What are the key properties of methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate?
methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate has a molecular weight of 341.72 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2-(5-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 169264966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).