About 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine
2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine (PubChem CID 169264972) has the molecular formula C16H11ClF3N
and a molecular weight of 309.72 g/mol. Its IUPAC name is 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine.
Molecular Properties
| Compound Name | 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine |
| PubChem CID | 169264972 |
| Molecular Formula | C16H11ClF3N |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine |
| SMILES | C=C(c1ccc(F)c(-c2cc(Cl)c(F)cc2F)n1)C1CC1 |
| InChI | InChI=1S/C16H11ClF3N/c1-8(9-2-3-9)15-5-4-12(18)16(21-15)10-6-11(17)14(20)7-13(10)19/h4-7,9H,1-3H2 |
| InChIKey | IBQDXVGEXLOVPV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine?
The IUPAC name of 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine (CID 169264972) is 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine.
What is the SMILES notation for 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine?
The canonical SMILES for 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine is C=C(c1ccc(F)c(-c2cc(Cl)c(F)cc2F)n1)C1CC1.
What is the InChIKey of 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine?
The InChIKey is IBQDXVGEXLOVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClF3N/c1-8(9-2-3-9)15-5-4-12(18)16(21-15)10-6-11(17)14(20)7-13(10)19/h4-7,9H,1-3H2.
What are the key properties of 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine?
2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine has a molecular weight of 309.72 g/mol, XLogP of 5.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2,4-difluorophenyl)-6-(1-cyclopropylethenyl)-3-fluoropyridine is sourced from PubChem (CID 169264972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).