C25H29N7O3S — CID 169265251
N,N'-diamino-2-[2-[2-(2-cyclopropyl-4-methoxyphenyl)-8-hydroxy-4-oxo-[1]benzothiolo[2,3-d]pyrimidin-3-yl]ethylamino]-N-methylethanimidamide (PubChem CID 169265251) has the molecular formula C25H29N7O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is N,N'-diamino-2-[2-[2-(2-cyclopropyl-4-methoxyphenyl)-8-hydroxy-4-oxo-[1]benzothiolo[2,3-d]pyrimidin-3-yl]ethylamino]-N-methylethanimidamide.
| Compound Name | N,N'-diamino-2-[2-[2-(2-cyclopropyl-4-methoxyphenyl)-8-hydroxy-4-oxo-[1]benzothiolo[2,3-d]pyrimidin-3-yl]ethylamino]-N-methylethanimidamide |
|---|---|
| PubChem CID | 169265251 |
| Molecular Formula | C25H29N7O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | N,N'-diamino-2-[2-[2-(2-cyclopropyl-4-methoxyphenyl)-8-hydroxy-4-oxo-[1]benzothiolo[2,3-d]pyrimidin-3-yl]ethylamino]-N-methylethanimidamide |
| SMILES | COc1ccc(-c2nc3sc4c(O)cccc4c3c(=O)n2CCNC/C(=N/N)N(C)N)c(C2CC2)c1 |
| InChI | InChI=1S/C25H29N7O3S/c1-31(27)20(30-26)13-28-10-11-32-23(16-9-8-15(35-2)12-18(16)14-6-7-14)29-24-21(25(32)34)17-4-3-5-19(33)22(17)36-24/h3-5,8-9,12,14,28,33H,6-7,10-11,13,26-27H2,1-2H3/b30-20- |
| InChIKey | SJBRNRYEFQNULS-COEJQBHMSA-N |
| XLogP | 2.54 |
| TPSA | 144.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|