C17H20N2O4S2 — CID 16926546
N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzenesulfonamide (PubChem CID 16926546) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzenesulfonamide.
| Compound Name | N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 16926546 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(2-ethylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzenesulfonamide |
| SMILES | CCS(=O)(=O)N1CCc2ccc(NS(=O)(=O)c3ccccc3)cc2C1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-2-24(20,21)19-11-10-14-8-9-16(12-15(14)13-19)18-25(22,23)17-6-4-3-5-7-17/h3-9,12,18H,2,10-11,13H2,1H3 |
| InChIKey | KRJLBXUQONIKGR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |