C15H30F2N2O — CID 169266269
4,4-difluoro-1-propan-2-ylpiperidine;4-propan-2-ylmorpholine (PubChem CID 169266269) has the molecular formula C15H30F2N2O and a molecular weight of 292.41 g/mol. Its IUPAC name is 4,4-difluoro-1-propan-2-ylpiperidine;4-propan-2-ylmorpholine.
| Compound Name | 4,4-difluoro-1-propan-2-ylpiperidine;4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 169266269 |
| Molecular Formula | C15H30F2N2O |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 4,4-difluoro-1-propan-2-ylpiperidine;4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCC(F)(F)CC1.CC(C)N1CCOCC1 |
| InChI | InChI=1S/C8H15F2N.C7H15NO/c1-7(2)11-5-3-8(9,10)4-6-11;1-7(2)8-3-5-9-6-4-8/h7H,3-6H2,1-2H3;7H,3-6H2,1-2H3 |
| InChIKey | CJUPKICEHHLJHZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |