About 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole
4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole (PubChem CID 169266296) has the molecular formula C10H10F2N2S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole |
| PubChem CID | 169266296 |
| Molecular Formula | C10H10F2N2S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole |
| SMILES | C#Cc1nc(N2CCC(F)(F)CC2)cs1 |
| InChI | InChI=1S/C10H10F2N2S/c1-2-9-13-8(7-15-9)14-5-3-10(11,12)4-6-14/h1,7H,3-6H2 |
| InChIKey | HBKZJPPCMLRVNH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole?
The IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole (CID 169266296) is 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole.
What is the SMILES notation for 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole?
The canonical SMILES for 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole is C#Cc1nc(N2CCC(F)(F)CC2)cs1.
What is the InChIKey of 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole?
The InChIKey is HBKZJPPCMLRVNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F2N2S/c1-2-9-13-8(7-15-9)14-5-3-10(11,12)4-6-14/h1,7H,3-6H2.
What are the key properties of 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole?
4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole has a molecular weight of 228.27 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluoropiperidin-1-yl)-2-ethynyl-1,3-thiazole is sourced from PubChem (CID 169266296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).