About 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine
1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine (PubChem CID 169266422) has the molecular formula C9H12BrF2N3
and a molecular weight of 280.12 g/mol. Its IUPAC name is 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine |
| PubChem CID | 169266422 |
| Molecular Formula | C9H12BrF2N3 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine |
| SMILES | Cn1cc(Br)nc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H12BrF2N3/c1-14-6-7(10)13-8(14)15-4-2-9(11,12)3-5-15/h6H,2-5H2,1H3 |
| InChIKey | CWBGBJHANGIQJR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine?
The IUPAC name of 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine (CID 169266422) is 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine.
What is the SMILES notation for 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine?
The canonical SMILES for 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine is Cn1cc(Br)nc1N1CCC(F)(F)CC1.
What is the InChIKey of 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine?
The InChIKey is CWBGBJHANGIQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrF2N3/c1-14-6-7(10)13-8(14)15-4-2-9(11,12)3-5-15/h6H,2-5H2,1H3.
What are the key properties of 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine?
1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine has a molecular weight of 280.12 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-1-methylimidazol-2-yl)-4,4-difluoropiperidine is sourced from PubChem (CID 169266422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).