About 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine
3-(1-ethoxyethenyl)-2,5-dimethylpyrazine (PubChem CID 169267308) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine.
Molecular Properties
| Compound Name | 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine |
| PubChem CID | 169267308 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine |
| SMILES | C=C(OCC)c1nc(C)cnc1C |
| InChI | InChI=1S/C10H14N2O/c1-5-13-9(4)10-8(3)11-6-7(2)12-10/h6H,4-5H2,1-3H3 |
| InChIKey | XKZWHSCTTQGFFQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine?
The IUPAC name of 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine (CID 169267308) is 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine.
What is the SMILES notation for 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine?
The canonical SMILES for 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine is C=C(OCC)c1nc(C)cnc1C.
What is the InChIKey of 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine?
The InChIKey is XKZWHSCTTQGFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-5-13-9(4)10-8(3)11-6-7(2)12-10/h6H,4-5H2,1-3H3.
What are the key properties of 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine?
3-(1-ethoxyethenyl)-2,5-dimethylpyrazine has a molecular weight of 178.23 g/mol, XLogP of 2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-ethoxyethenyl)-2,5-dimethylpyrazine is sourced from PubChem (CID 169267308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).