C27H29ClN4O2S — CID 169268715
8-[1-[[2-(tert-butylamino)sulfanyl-6-chloro-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-2-ylchromen-4-one (PubChem CID 169268715) has the molecular formula C27H29ClN4O2S and a molecular weight of 509.08 g/mol. Its IUPAC name is 8-[1-[[2-(tert-butylamino)sulfanyl-6-chloro-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-2-ylchromen-4-one.
| Compound Name | 8-[1-[[2-(tert-butylamino)sulfanyl-6-chloro-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-2-ylchromen-4-one |
|---|---|
| PubChem CID | 169268715 |
| Molecular Formula | C27H29ClN4O2S |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 8-[1-[[2-(tert-butylamino)sulfanyl-6-chloro-3-pyridinyl]amino]ethyl]-3,6-dimethyl-2-pyridin-2-ylchromen-4-one |
| SMILES | Cc1cc(C(C)Nc2ccc(Cl)nc2SNC(C)(C)C)c2oc(-c3ccccn3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C27H29ClN4O2S/c1-15-13-18(17(3)30-21-10-11-22(28)31-26(21)35-32-27(4,5)6)25-19(14-15)23(33)16(2)24(34-25)20-9-7-8-12-29-20/h7-14,17,30,32H,1-6H3 |
| InChIKey | FMFRLVNZRNBAAE-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|