C14H22N2O2 — CID 169269117
ethane;3-methyl-N-(oxolan-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 169269117) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethane;3-methyl-N-(oxolan-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | ethane;3-methyl-N-(oxolan-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 169269117 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;3-methyl-N-(oxolan-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | CC.Cc1cccnc1C(=O)NCC1CCOC1 |
| InChI | InChI=1S/C12H16N2O2.C2H6/c1-9-3-2-5-13-11(9)12(15)14-7-10-4-6-16-8-10;1-2/h2-3,5,10H,4,6-8H2,1H3,(H,14,15);1-2H3 |
| InChIKey | SNWWYOCWYZDMII-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |